C15H7ClF7N3O4 — CID 171138890
N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 171138890) has the molecular formula C15H7ClF7N3O4 and a molecular weight of 461.68 g/mol. Its IUPAC name is N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 171138890 |
| Molecular Formula | C15H7ClF7N3O4 |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 461.00 |
| IUPAC Name | N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C(NN=Cc1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H7ClF7N3O4/c16-10-3-1-7(26(28)29)5-9(10)11-4-2-8(30-11)6-24-25-12(27)13(17,18)14(19,20)15(21,22)23/h1-6H,(H,25,27) |
| InChIKey | COQFZQQJNCZFSP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|