C17H10ClN5O7 — CID 3392623
N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2,4-dinitroaniline (PubChem CID 3392623) has the molecular formula C17H10ClN5O7 and a molecular weight of 431.75 g/mol. Its IUPAC name is N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 3392623 |
| Molecular Formula | C17H10ClN5O7 |
| Molecular Weight | 431.75 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(-c2ccc(C=NNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])o2)c1 |
| InChI | InChI=1S/C17H10ClN5O7/c18-14-4-1-10(21(24)25)7-13(14)17-6-3-12(30-17)9-19-20-15-5-2-11(22(26)27)8-16(15)23(28)29/h1-9,20H |
| InChIKey | OONAACWQFQNGFL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 166.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.75 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|