C25H18ClN3O5 — CID 3958569
N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 3958569) has the molecular formula C25H18ClN3O5 and a molecular weight of 475.89 g/mol. Its IUPAC name is N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 3958569 |
| Molecular Formula | C25H18ClN3O5 |
| Molecular Weight | 475.89 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | O=C(NN=Cc1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H18ClN3O5/c26-22-13-11-19(29(32)33)15-21(22)23-14-12-20(34-23)16-27-28-24(30)25(31,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-16,31H,(H,28,30) |
| InChIKey | CEKAACAAWUNXLD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|