C25H19N3O6 — CID 137062754
2-hydroxy-N-[(E)-[5-(2-hydroxy-5-nitrophenyl)furan-2-yl]methylideneamino]-2,2-diphenylacetamide (PubChem CID 137062754) has the molecular formula C25H19N3O6 and a molecular weight of 457.44 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-[5-(2-hydroxy-5-nitrophenyl)furan-2-yl]methylideneamino]-2,2-diphenylacetamide.
| Compound Name | 2-hydroxy-N-[(E)-[5-(2-hydroxy-5-nitrophenyl)furan-2-yl]methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 137062754 |
| Molecular Formula | C25H19N3O6 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-hydroxy-N-[(E)-[5-(2-hydroxy-5-nitrophenyl)furan-2-yl]methylideneamino]-2,2-diphenylacetamide |
| SMILES | O=C(N/N=C/c1ccc(-c2cc([N+](=O)[O-])ccc2O)o1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H19N3O6/c29-22-13-11-19(28(32)33)15-21(22)23-14-12-20(34-23)16-26-27-24(30)25(31,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-16,29,31H,(H,27,30)/b26-16+ |
| InChIKey | VUXYGIOVFPTVDF-WGOQTCKBSA-N |
| XLogP | 3.95 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|