C23H14Br2N6O7 — CID 18529994
1-[(Z)-[5-(2-bromo-5-nitrophenyl)furan-2-yl]methylideneamino]-3-[(E)-[5-(2-bromo-5-nitrophenyl)furan-2-yl]methylideneamino]urea (PubChem CID 18529994) has the molecular formula C23H14Br2N6O7 and a molecular weight of 646.21 g/mol. Its IUPAC name is 1-[(Z)-[5-(2-bromo-5-nitrophenyl)furan-2-yl]methylideneamino]-3-[(E)-[5-(2-bromo-5-nitrophenyl)furan-2-yl]methylideneamino]urea.
| Compound Name | 1-[(Z)-[5-(2-bromo-5-nitrophenyl)furan-2-yl]methylideneamino]-3-[(E)-[5-(2-bromo-5-nitrophenyl)furan-2-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 18529994 |
| Molecular Formula | C23H14Br2N6O7 |
| Molecular Weight | 646.21 g/mol |
| Exact Mass | 643.93 |
| IUPAC Name | 1-[(Z)-[5-(2-bromo-5-nitrophenyl)furan-2-yl]methylideneamino]-3-[(E)-[5-(2-bromo-5-nitrophenyl)furan-2-yl]methylideneamino]urea |
| SMILES | O=C(N/N=C\c1ccc(-c2cc([N+](=O)[O-])ccc2Br)o1)N/N=C/c1ccc(-c2cc([N+](=O)[O-])ccc2Br)o1 |
| InChI | InChI=1S/C23H14Br2N6O7/c24-19-5-1-13(30(33)34)9-17(19)21-7-3-15(37-21)11-26-28-23(32)29-27-12-16-4-8-22(38-16)18-10-14(31(35)36)2-6-20(18)25/h1-12H,(H2,28,29,32)/b26-11-,27-12+ |
| InChIKey | XWJBDZQDZCRFRF-BWGHBQEHSA-N |
| XLogP | 6.22 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.21 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|