C14H9BrN4O4 — CID 3747080
N-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-cyanoacetamide (PubChem CID 3747080) has the molecular formula C14H9BrN4O4 and a molecular weight of 377.15 g/mol. Its IUPAC name is N-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-cyanoacetamide.
| Compound Name | N-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-cyanoacetamide |
|---|---|
| PubChem CID | 3747080 |
| Molecular Formula | C14H9BrN4O4 |
| Molecular Weight | 377.15 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | N-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-cyanoacetamide |
| SMILES | N#CCC(=O)NN=Cc1ccc(-c2ccc([N+](=O)[O-])cc2Br)o1 |
| InChI | InChI=1S/C14H9BrN4O4/c15-12-7-9(19(21)22)1-3-11(12)13-4-2-10(23-13)8-17-18-14(20)5-6-16/h1-4,7-8H,5H2,(H,18,20) |
| InChIKey | BIZQMSXDLCXZAX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|