C16H12BrN5O4S2 — CID 6176282
N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 6176282) has the molecular formula C16H12BrN5O4S2 and a molecular weight of 482.34 g/mol. Its IUPAC name is N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 6176282 |
| Molecular Formula | C16H12BrN5O4S2 |
| Molecular Weight | 482.34 g/mol |
| Exact Mass | 480.95 |
| IUPAC Name | N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1nnc(SCC(=O)N/N=C\c2ccc(-c3ccc([N+](=O)[O-])cc3Br)o2)s1 |
| InChI | InChI=1S/C16H12BrN5O4S2/c1-9-19-21-16(28-9)27-8-15(23)20-18-7-11-3-5-14(26-11)12-4-2-10(22(24)25)6-13(12)17/h2-7H,8H2,1H3,(H,20,23)/b18-7- |
| InChIKey | XVWBHCNHKWQSPF-WSVATBPTSA-N |
| XLogP | 4.02 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|