C25H24BrN5O7 — CID 126175414
N-[(2S)-1-[(2Z)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-3,5-dinitrobenzamide (PubChem CID 126175414) has the molecular formula C25H24BrN5O7 and a molecular weight of 586.40 g/mol. Its IUPAC name is N-[(2S)-1-[(2Z)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[(2S)-1-[(2Z)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 126175414 |
| Molecular Formula | C25H24BrN5O7 |
| Molecular Weight | 586.40 g/mol |
| Exact Mass | 585.09 |
| IUPAC Name | N-[(2S)-1-[(2Z)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-3,5-dinitrobenzamide |
| SMILES | Cc1ccc(-c2ccc(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)o2)c(Br)c1 |
| InChI | InChI=1S/C25H24BrN5O7/c1-14(2)8-22(28-24(32)16-10-17(30(34)35)12-18(11-16)31(36)37)25(33)29-27-13-19-5-7-23(38-19)20-6-4-15(3)9-21(20)26/h4-7,9-14,22H,8H2,1-3H3,(H,28,32)(H,29,33)/b27-13-/t22-/m0/s1 |
| InChIKey | PZMVILWZNKMRNZ-MRGCCAAOSA-N |
| XLogP | 5.13 |
| TPSA | 169.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|