C25H26BrN3O3 — CID 126157843
N-[(2R)-1-[(2E)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-methylbenzamide (PubChem CID 126157843) has the molecular formula C25H26BrN3O3 and a molecular weight of 496.41 g/mol. Its IUPAC name is N-[(2R)-1-[(2E)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-methylbenzamide.
| Compound Name | N-[(2R)-1-[(2E)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 126157843 |
| Molecular Formula | C25H26BrN3O3 |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | N-[(2R)-1-[(2E)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N[C@@H](C(=O)N/N=C/c2ccc(-c3ccc(C)cc3Br)o2)C(C)C)c1 |
| InChI | InChI=1S/C25H26BrN3O3/c1-15(2)23(28-24(30)18-7-5-6-16(3)12-18)25(31)29-27-14-19-9-11-22(32-19)20-10-8-17(4)13-21(20)26/h5-15,23H,1-4H3,(H,28,30)(H,29,31)/b27-14+/t23-/m1/s1 |
| InChIKey | HEANGBQDRGZMMA-VXYCCBPDSA-N |
| XLogP | 5.23 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|