C25H22BrN3O2 — CID 126233765
N-[(Z)-[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4-(2,5-dimethylpyrrol-1-yl)benzamide (PubChem CID 126233765) has the molecular formula C25H22BrN3O2 and a molecular weight of 476.37 g/mol. Its IUPAC name is N-[(Z)-[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4-(2,5-dimethylpyrrol-1-yl)benzamide.
| Compound Name | N-[(Z)-[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4-(2,5-dimethylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 126233765 |
| Molecular Formula | C25H22BrN3O2 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[(Z)-[5-(2-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4-(2,5-dimethylpyrrol-1-yl)benzamide |
| SMILES | Cc1ccc(-c2ccc(/C=N\NC(=O)c3ccc(-n4c(C)ccc4C)cc3)o2)c(Br)c1 |
| InChI | InChI=1S/C25H22BrN3O2/c1-16-4-12-22(23(26)14-16)24-13-11-21(31-24)15-27-28-25(30)19-7-9-20(10-8-19)29-17(2)5-6-18(29)3/h4-15H,1-3H3,(H,28,30)/b27-15- |
| InChIKey | PZTANACAHWGMQK-DICXZTSXSA-N |
| XLogP | 6.19 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|