C12H10BrNO2 — CID 50879288
(NE)-N-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydroxylamine (PubChem CID 50879288) has the molecular formula C12H10BrNO2 and a molecular weight of 280.12 g/mol. Its IUPAC name is (NE)-N-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 50879288 |
| Molecular Formula | C12H10BrNO2 |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | (NE)-N-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydroxylamine |
| SMILES | Cc1ccc(-c2ccc(/C=N/O)o2)c(Br)c1 |
| InChI | InChI=1S/C12H10BrNO2/c1-8-2-4-10(11(13)6-8)12-5-3-9(16-12)7-14-15/h2-7,15H,1H3/b14-7+ |
| InChIKey | UMIRLYBZAWOWOU-VGOFMYFVSA-N |
| XLogP | 3.83 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|