C18H12BrCl2NO — CID 126253258
1-[5-(2-bromo-4-methylphenyl)furan-2-yl]-N-(3,4-dichlorophenyl)methanimine (PubChem CID 126253258) has the molecular formula C18H12BrCl2NO and a molecular weight of 409.11 g/mol. Its IUPAC name is 1-[5-(2-bromo-4-methylphenyl)furan-2-yl]-N-(3,4-dichlorophenyl)methanimine.
| Compound Name | 1-[5-(2-bromo-4-methylphenyl)furan-2-yl]-N-(3,4-dichlorophenyl)methanimine |
|---|---|
| PubChem CID | 126253258 |
| Molecular Formula | C18H12BrCl2NO |
| Molecular Weight | 409.11 g/mol |
| Exact Mass | 406.95 |
| IUPAC Name | 1-[5-(2-bromo-4-methylphenyl)furan-2-yl]-N-(3,4-dichlorophenyl)methanimine |
| SMILES | Cc1ccc(-c2ccc(/C=N/c3ccc(Cl)c(Cl)c3)o2)c(Br)c1 |
| InChI | InChI=1S/C18H12BrCl2NO/c1-11-2-5-14(15(19)8-11)18-7-4-13(23-18)10-22-12-3-6-16(20)17(21)9-12/h2-10H,1H3/b22-10+ |
| InChIKey | BQKFLAPJJIIVHK-LSHDLFTRSA-N |
| XLogP | 7.07 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.11 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|