C25H16Cl2N2O2 — CID 171979302
1-[5-(3,4-dichlorophenyl)furan-2-yl]-N-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine (PubChem CID 171979302) has the molecular formula C25H16Cl2N2O2 and a molecular weight of 447.32 g/mol. Its IUPAC name is 1-[5-(3,4-dichlorophenyl)furan-2-yl]-N-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine.
| Compound Name | 1-[5-(3,4-dichlorophenyl)furan-2-yl]-N-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 171979302 |
| Molecular Formula | C25H16Cl2N2O2 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 1-[5-(3,4-dichlorophenyl)furan-2-yl]-N-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]methanimine |
| SMILES | Cc1ccc2oc(-c3ccc(/N=C/c4ccc(-c5ccc(Cl)c(Cl)c5)o4)cc3)nc2c1 |
| InChI | InChI=1S/C25H16Cl2N2O2/c1-15-2-10-24-22(12-15)29-25(31-24)16-3-6-18(7-4-16)28-14-19-8-11-23(30-19)17-5-9-20(26)21(27)13-17/h2-14H,1H3/b28-14+ |
| InChIKey | JXKKEVBDPJPMMH-CCVNUDIWSA-N |
| XLogP | 8.12 |
| TPSA | 51.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|