C25H16FN3O4 — CID 4094834
N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-1-[5-(4-methyl-3-nitrophenyl)furan-2-yl]methanimine (PubChem CID 4094834) has the molecular formula C25H16FN3O4 and a molecular weight of 441.42 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-1-[5-(4-methyl-3-nitrophenyl)furan-2-yl]methanimine.
| Compound Name | N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-1-[5-(4-methyl-3-nitrophenyl)furan-2-yl]methanimine |
|---|---|
| PubChem CID | 4094834 |
| Molecular Formula | C25H16FN3O4 |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-1-[5-(4-methyl-3-nitrophenyl)furan-2-yl]methanimine |
| SMILES | Cc1ccc(-c2ccc(/C=N/c3ccc4oc(-c5ccc(F)cc5)nc4c3)o2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H16FN3O4/c1-15-2-3-17(12-22(15)29(30)31)23-11-9-20(32-23)14-27-19-8-10-24-21(13-19)28-25(33-24)16-4-6-18(26)7-5-16/h2-14H,1H3/b27-14+ |
| InChIKey | PMRDVMNCLXIPOJ-MZJWZYIUSA-N |
| XLogP | 6.86 |
| TPSA | 94.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|