C22H14FN3O3 — CID 3096684
N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-3-(2-nitrophenyl)prop-2-en-1-imine (PubChem CID 3096684) has the molecular formula C22H14FN3O3 and a molecular weight of 387.37 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-3-(2-nitrophenyl)prop-2-en-1-imine.
| Compound Name | N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-3-(2-nitrophenyl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 3096684 |
| Molecular Formula | C22H14FN3O3 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]-3-(2-nitrophenyl)prop-2-en-1-imine |
| SMILES | O=[N+]([O-])c1ccccc1C=C/C=N/c1ccc2oc(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C22H14FN3O3/c23-17-9-7-16(8-10-17)22-25-19-14-18(11-12-21(19)29-22)24-13-3-5-15-4-1-2-6-20(15)26(27)28/h1-14H/b5-3?,24-13+ |
| InChIKey | YXJNLFOSNVMFJX-LOIIQUINSA-N |
| XLogP | 5.96 |
| TPSA | 81.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|