C24H20N4O3 — CID 4551622
N,N-dimethyl-4-[5-[3-(3-nitrophenyl)prop-2-enylideneamino]-1,3-benzoxazol-2-yl]aniline (PubChem CID 4551622) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is N,N-dimethyl-4-[5-[3-(3-nitrophenyl)prop-2-enylideneamino]-1,3-benzoxazol-2-yl]aniline.
| Compound Name | N,N-dimethyl-4-[5-[3-(3-nitrophenyl)prop-2-enylideneamino]-1,3-benzoxazol-2-yl]aniline |
|---|---|
| PubChem CID | 4551622 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N,N-dimethyl-4-[5-[3-(3-nitrophenyl)prop-2-enylideneamino]-1,3-benzoxazol-2-yl]aniline |
| SMILES | CN(C)c1ccc(-c2nc3cc(/N=C/C=Cc4cccc([N+](=O)[O-])c4)ccc3o2)cc1 |
| InChI | InChI=1S/C24H20N4O3/c1-27(2)20-11-8-18(9-12-20)24-26-22-16-19(10-13-23(22)31-24)25-14-4-6-17-5-3-7-21(15-17)28(29)30/h3-16H,1-2H3/b6-4?,25-14+ |
| InChIKey | GBAPMYAVIZFBQD-NURAAKSPSA-N |
| XLogP | 5.88 |
| TPSA | 84.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|