C23H21N4O3+ — CID 143730266
[3-[[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]iminomethyl]-4-hydroxyphenyl]-methyl-oxoazanium (PubChem CID 143730266) has the molecular formula C23H21N4O3+ and a molecular weight of 401.45 g/mol. Its IUPAC name is [3-[[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]iminomethyl]-4-hydroxyphenyl]-methyl-oxoazanium.
| Compound Name | [3-[[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]iminomethyl]-4-hydroxyphenyl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 143730266 |
| Molecular Formula | C23H21N4O3+ |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [3-[[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]iminomethyl]-4-hydroxyphenyl]-methyl-oxoazanium |
| SMILES | CN(C)c1ccc(-c2nc3cc(/N=C/c4cc([N+](C)=O)ccc4O)ccc3o2)cc1 |
| InChI | InChI=1S/C23H20N4O3/c1-26(2)18-7-4-15(5-8-18)23-25-20-13-17(6-11-22(20)30-23)24-14-16-12-19(27(3)29)9-10-21(16)28/h4-14H,1-3H3/p+1 |
| InChIKey | LYWRDEMAZQQRLD-UHFFFAOYSA-O |
| XLogP | 5.06 |
| TPSA | 81.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|