C21H15BrN2O2 — CID 3503119
2-[[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-methylphenol (PubChem CID 3503119) has the molecular formula C21H15BrN2O2 and a molecular weight of 407.27 g/mol. Its IUPAC name is 2-[[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-methylphenol.
| Compound Name | 2-[[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-methylphenol |
|---|---|
| PubChem CID | 3503119 |
| Molecular Formula | C21H15BrN2O2 |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 2-[[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(/C=N/c2ccc3oc(-c4ccc(Br)cc4)nc3c2)c1 |
| InChI | InChI=1S/C21H15BrN2O2/c1-13-2-8-19(25)15(10-13)12-23-17-7-9-20-18(11-17)24-21(26-20)14-3-5-16(22)6-4-14/h2-12,25H,1H3/b23-12+ |
| InChIKey | USVPBOCUVWUSRG-FSJBWODESA-N |
| XLogP | 6.02 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|