C22H17BrN2O3 — CID 135556340
2-bromo-6-[[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-methylphenol (PubChem CID 135556340) has the molecular formula C22H17BrN2O3 and a molecular weight of 437.29 g/mol. Its IUPAC name is 2-bromo-6-[[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-methylphenol.
| Compound Name | 2-bromo-6-[[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-methylphenol |
|---|---|
| PubChem CID | 135556340 |
| Molecular Formula | C22H17BrN2O3 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 2-bromo-6-[[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]-4-methylphenol |
| SMILES | Cc1cc(Br)c(O)c(/C=N/c2ccc(O)c(-c3nc4cc(C)ccc4o3)c2)c1 |
| InChI | InChI=1S/C22H17BrN2O3/c1-12-3-6-20-18(9-12)25-22(28-20)16-10-15(4-5-19(16)26)24-11-14-7-13(2)8-17(23)21(14)27/h3-11,26-27H,1-2H3/b24-11+ |
| InChIKey | ZIRVCBXRZVPVST-BHGWPJFGSA-N |
| XLogP | 6.04 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|