C27H18BrClN2O3 — CID 135573868
2-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]iminomethyl]-6-bromo-4-[(2-chlorophenyl)methyl]phenol (PubChem CID 135573868) has the molecular formula C27H18BrClN2O3 and a molecular weight of 533.81 g/mol. Its IUPAC name is 2-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]iminomethyl]-6-bromo-4-[(2-chlorophenyl)methyl]phenol.
| Compound Name | 2-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]iminomethyl]-6-bromo-4-[(2-chlorophenyl)methyl]phenol |
|---|---|
| PubChem CID | 135573868 |
| Molecular Formula | C27H18BrClN2O3 |
| Molecular Weight | 533.81 g/mol |
| Exact Mass | 532.02 |
| IUPAC Name | 2-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]iminomethyl]-6-bromo-4-[(2-chlorophenyl)methyl]phenol |
| SMILES | Oc1ccc(/N=C/c2cc(Cc3ccccc3Cl)cc(Br)c2O)cc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C27H18BrClN2O3/c28-21-13-16(11-17-5-1-2-6-22(17)29)12-18(26(21)33)15-30-19-9-10-24(32)20(14-19)27-31-23-7-3-4-8-25(23)34-27/h1-10,12-15,32-33H,11H2/b30-15+ |
| InChIKey | ROYLLRNWCLAIQL-FJEPWZHXSA-N |
| XLogP | 7.66 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.81 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|