C29H22ClN3O5 — CID 3513482
4-[(2-chlorophenyl)methyl]-2-[[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-hydroxyphenyl]iminomethyl]-6-nitrophenol (PubChem CID 3513482) has the molecular formula C29H22ClN3O5 and a molecular weight of 527.96 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-2-[[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-hydroxyphenyl]iminomethyl]-6-nitrophenol.
| Compound Name | 4-[(2-chlorophenyl)methyl]-2-[[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-hydroxyphenyl]iminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 3513482 |
| Molecular Formula | C29H22ClN3O5 |
| Molecular Weight | 527.96 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-2-[[3-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-hydroxyphenyl]iminomethyl]-6-nitrophenol |
| SMILES | Cc1cc2nc(-c3cccc(/N=C/c4cc(Cc5ccccc5Cl)cc([N+](=O)[O-])c4O)c3O)oc2cc1C |
| InChI | InChI=1S/C29H22ClN3O5/c1-16-10-24-26(11-17(16)2)38-29(32-24)21-7-5-9-23(28(21)35)31-15-20-13-18(14-25(27(20)34)33(36)37)12-19-6-3-4-8-22(19)30/h3-11,13-15,34-35H,12H2,1-2H3/b31-15+ |
| InChIKey | GTPPUUSDNILDOK-IBBHUPRXSA-N |
| XLogP | 7.43 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.96 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|