C31H26ClN3O4 — CID 136886887
2-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]iminomethyl]-4-[(2-chlorophenyl)methyl]-6-nitrophenol (PubChem CID 136886887) has the molecular formula C31H26ClN3O4 and a molecular weight of 540.02 g/mol. Its IUPAC name is 2-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]iminomethyl]-4-[(2-chlorophenyl)methyl]-6-nitrophenol.
| Compound Name | 2-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]iminomethyl]-4-[(2-chlorophenyl)methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 136886887 |
| Molecular Formula | C31H26ClN3O4 |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]iminomethyl]-4-[(2-chlorophenyl)methyl]-6-nitrophenol |
| SMILES | CC[C@@H](C)c1ccc2oc(-c3ccc(/N=C/c4cc(Cc5ccccc5Cl)cc([N+](=O)[O-])c4O)cc3)nc2c1 |
| InChI | InChI=1S/C31H26ClN3O4/c1-3-19(2)22-10-13-29-27(17-22)34-31(39-29)21-8-11-25(12-9-21)33-18-24-15-20(16-28(30(24)36)35(37)38)14-23-6-4-5-7-26(23)32/h4-13,15-19,36H,3,14H2,1-2H3/b33-18+/t19-/m1/s1 |
| InChIKey | XFVXSKSZWRHOIJ-CEQVMOKUSA-N |
| XLogP | 8.62 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|