C25H23BrN2O2 — CID 135938356
4-bromo-2-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]iminomethyl]-6-methylphenol (PubChem CID 135938356) has the molecular formula C25H23BrN2O2 and a molecular weight of 463.38 g/mol. Its IUPAC name is 4-bromo-2-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]iminomethyl]-6-methylphenol.
| Compound Name | 4-bromo-2-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]iminomethyl]-6-methylphenol |
|---|---|
| PubChem CID | 135938356 |
| Molecular Formula | C25H23BrN2O2 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 4-bromo-2-[[4-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]iminomethyl]-6-methylphenol |
| SMILES | CC[C@@H](C)c1ccc2oc(-c3ccc(/N=C/c4cc(Br)cc(C)c4O)cc3)nc2c1 |
| InChI | InChI=1S/C25H23BrN2O2/c1-4-15(2)18-7-10-23-22(13-18)28-25(30-23)17-5-8-21(9-6-17)27-14-19-12-20(26)11-16(3)24(19)29/h5-15,29H,4H2,1-3H3/b27-14+/t15-/m1/s1 |
| InChIKey | QSKGIYXYULYGAZ-PJAVDKHJSA-N |
| XLogP | 7.54 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|