C18H20N2O — CID 40526857
5-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-methylaniline (PubChem CID 40526857) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-methylaniline.
| Compound Name | 5-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-methylaniline |
|---|---|
| PubChem CID | 40526857 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 5-[5-[(2R)-butan-2-yl]-1,3-benzoxazol-2-yl]-2-methylaniline |
| SMILES | CC[C@@H](C)c1ccc2oc(-c3ccc(C)c(N)c3)nc2c1 |
| InChI | InChI=1S/C18H20N2O/c1-4-11(2)13-7-8-17-16(10-13)20-18(21-17)14-6-5-12(3)15(19)9-14/h5-11H,4,19H2,1-3H3/t11-/m1/s1 |
| InChIKey | QXMTZZDHFZAHRG-LLVKDONJSA-N |
| XLogP | 4.90 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|