C18H19ClN2O — CID 960798
2-chloro-5-[5-[(2R)-pentan-2-yl]-1,3-benzoxazol-2-yl]aniline (PubChem CID 960798) has the molecular formula C18H19ClN2O and a molecular weight of 314.82 g/mol. Its IUPAC name is 2-chloro-5-[5-[(2R)-pentan-2-yl]-1,3-benzoxazol-2-yl]aniline.
| Compound Name | 2-chloro-5-[5-[(2R)-pentan-2-yl]-1,3-benzoxazol-2-yl]aniline |
|---|---|
| PubChem CID | 960798 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-chloro-5-[5-[(2R)-pentan-2-yl]-1,3-benzoxazol-2-yl]aniline |
| SMILES | CCC[C@@H](C)c1ccc2oc(-c3ccc(Cl)c(N)c3)nc2c1 |
| InChI | InChI=1S/C18H19ClN2O/c1-3-4-11(2)12-6-8-17-16(10-12)21-18(22-17)13-5-7-14(19)15(20)9-13/h5-11H,3-4,20H2,1-2H3/t11-/m1/s1 |
| InChIKey | OHVCETYPKFZZFI-LLVKDONJSA-N |
| XLogP | 5.63 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|