C21H17ClN2O5 — CID 132569968
[2-(3-amino-4-chlorophenyl)-6-oxopyrano[3,2-f][1,3]benzoxazol-8-yl]methyl butanoate (PubChem CID 132569968) has the molecular formula C21H17ClN2O5 and a molecular weight of 412.83 g/mol. Its IUPAC name is [2-(3-amino-4-chlorophenyl)-6-oxopyrano[3,2-f][1,3]benzoxazol-8-yl]methyl butanoate.
| Compound Name | [2-(3-amino-4-chlorophenyl)-6-oxopyrano[3,2-f][1,3]benzoxazol-8-yl]methyl butanoate |
|---|---|
| PubChem CID | 132569968 |
| Molecular Formula | C21H17ClN2O5 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | [2-(3-amino-4-chlorophenyl)-6-oxopyrano[3,2-f][1,3]benzoxazol-8-yl]methyl butanoate |
| SMILES | CCCC(=O)OCc1cc(=O)oc2cc3oc(-c4ccc(Cl)c(N)c4)nc3cc12 |
| InChI | InChI=1S/C21H17ClN2O5/c1-2-3-19(25)27-10-12-7-20(26)28-17-9-18-16(8-13(12)17)24-21(29-18)11-4-5-14(22)15(23)6-11/h4-9H,2-3,10,23H2,1H3 |
| InChIKey | JOCFTHDAHNGFJG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|