C22H17ClN2O6 — CID 46825859
(6-chloro-7-ethyl-2-oxochromen-4-yl)methyl 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate (PubChem CID 46825859) has the molecular formula C22H17ClN2O6 and a molecular weight of 440.84 g/mol. Its IUPAC name is (6-chloro-7-ethyl-2-oxochromen-4-yl)methyl 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate.
| Compound Name | (6-chloro-7-ethyl-2-oxochromen-4-yl)methyl 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate |
|---|---|
| PubChem CID | 46825859 |
| Molecular Formula | C22H17ClN2O6 |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | (6-chloro-7-ethyl-2-oxochromen-4-yl)methyl 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate |
| SMILES | CCc1cc2oc(=O)cc(COC(=O)Cn3nc(-c4ccccc4)oc3=O)c2cc1Cl |
| InChI | InChI=1S/C22H17ClN2O6/c1-2-13-8-18-16(10-17(13)23)15(9-19(26)30-18)12-29-20(27)11-25-22(28)31-21(24-25)14-6-4-3-5-7-14/h3-10H,2,11-12H2,1H3 |
| InChIKey | KSKOVBJQAYKRLB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|