C21H17NO5 — CID 132569964
(6-oxo-2-phenylpyrano[3,2-f][1,3]benzoxazol-8-yl)methyl butanoate (PubChem CID 132569964) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is (6-oxo-2-phenylpyrano[3,2-f][1,3]benzoxazol-8-yl)methyl butanoate.
| Compound Name | (6-oxo-2-phenylpyrano[3,2-f][1,3]benzoxazol-8-yl)methyl butanoate |
|---|---|
| PubChem CID | 132569964 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (6-oxo-2-phenylpyrano[3,2-f][1,3]benzoxazol-8-yl)methyl butanoate |
| SMILES | CCCC(=O)OCc1cc(=O)oc2cc3oc(-c4ccccc4)nc3cc12 |
| InChI | InChI=1S/C21H17NO5/c1-2-6-19(23)25-12-14-9-20(24)26-17-11-18-16(10-15(14)17)22-21(27-18)13-7-4-3-5-8-13/h3-5,7-11H,2,6,12H2,1H3 |
| InChIKey | AXKUZTKSAAHGLW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 82.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|