C23H19NO5 — CID 7648539
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-methylquinoline-4-carboxylate (PubChem CID 7648539) has the molecular formula C23H19NO5 and a molecular weight of 389.41 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-methylquinoline-4-carboxylate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7648539 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 2-methylquinoline-4-carboxylate |
| SMILES | CCc1cc2c(COC(=O)c3cc(C)nc4ccccc34)cc(=O)oc2cc1O |
| InChI | InChI=1S/C23H19NO5/c1-3-14-9-17-15(10-22(26)29-21(17)11-20(14)25)12-28-23(27)18-8-13(2)24-19-7-5-4-6-16(18)19/h4-11,25H,3,12H2,1-2H3 |
| InChIKey | HYVYJQZJZCGZEQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|