C21H20O7 — CID 8528731
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 3,5-dimethoxybenzoate (PubChem CID 8528731) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 3,5-dimethoxybenzoate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 8528731 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 3,5-dimethoxybenzoate |
| SMILES | CCc1cc2c(COC(=O)c3cc(OC)cc(OC)c3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C21H20O7/c1-4-12-7-17-14(8-20(23)28-19(17)10-18(12)22)11-27-21(24)13-5-15(25-2)9-16(6-13)26-3/h5-10,22H,4,11H2,1-3H3 |
| InChIKey | GCGTYHYTISEQKV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|