C23H22O7 — CID 8604480
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 8604480) has the molecular formula C23H22O7 and a molecular weight of 410.42 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8604480 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCc1cc2c(COC(=O)/C=C/c3ccc(OC)cc3OC)cc(=O)oc2cc1O |
| InChI | InChI=1S/C23H22O7/c1-4-14-9-18-16(10-23(26)30-21(18)12-19(14)24)13-29-22(25)8-6-15-5-7-17(27-2)11-20(15)28-3/h5-12,24H,4,13H2,1-3H3/b8-6+ |
| InChIKey | RVKXLMSGRKOKPT-SOFGYWHQSA-N |
| XLogP | 3.83 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|