C21H19ClO7 — CID 7681334
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 3-chloro-4,5-dimethoxybenzoate (PubChem CID 7681334) has the molecular formula C21H19ClO7 and a molecular weight of 418.83 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 3-chloro-4,5-dimethoxybenzoate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 3-chloro-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7681334 |
| Molecular Formula | C21H19ClO7 |
| Molecular Weight | 418.83 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl 3-chloro-4,5-dimethoxybenzoate |
| SMILES | CCc1cc2c(COC(=O)c3cc(Cl)c(OC)c(OC)c3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C21H19ClO7/c1-4-11-5-14-13(8-19(24)29-17(14)9-16(11)23)10-28-21(25)12-6-15(22)20(27-3)18(7-12)26-2/h5-9,23H,4,10H2,1-3H3 |
| InChIKey | JCBDPILFJDNMHI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.83 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|