C19H14BrClO6 — CID 16513467
(7-bromo-2-oxochromen-4-yl)methyl 3-chloro-4,5-dimethoxybenzoate (PubChem CID 16513467) has the molecular formula C19H14BrClO6 and a molecular weight of 453.67 g/mol. Its IUPAC name is (7-bromo-2-oxochromen-4-yl)methyl 3-chloro-4,5-dimethoxybenzoate.
| Compound Name | (7-bromo-2-oxochromen-4-yl)methyl 3-chloro-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 16513467 |
| Molecular Formula | C19H14BrClO6 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 451.97 |
| IUPAC Name | (7-bromo-2-oxochromen-4-yl)methyl 3-chloro-4,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCc2cc(=O)oc3cc(Br)ccc23)cc(Cl)c1OC |
| InChI | InChI=1S/C19H14BrClO6/c1-24-16-6-10(5-14(21)18(16)25-2)19(23)26-9-11-7-17(22)27-15-8-12(20)3-4-13(11)15/h3-8H,9H2,1-2H3 |
| InChIKey | XQHNPKUERNDSNQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|