About (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate
(7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate (PubChem CID 139011407) has the molecular formula C17H10BrClO5
and a molecular weight of 409.62 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate.
Molecular Properties
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate |
| PubChem CID | 139011407 |
| Molecular Formula | C17H10BrClO5 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate |
| SMILES | O=C(OCc1cc(=O)oc2cc(O)ccc12)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C17H10BrClO5/c18-10-1-4-14(19)13(6-10)17(22)23-8-9-5-16(21)24-15-7-11(20)2-3-12(9)15/h1-7,20H,8H2 |
| InChIKey | SWEHLZCLNXASCI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate?
The IUPAC name of (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate (CID 139011407) is (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate.
What is the SMILES notation for (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate?
The canonical SMILES for (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate is O=C(OCc1cc(=O)oc2cc(O)ccc12)c1cc(Br)ccc1Cl.
What is the InChIKey of (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate?
The InChIKey is SWEHLZCLNXASCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10BrClO5/c18-10-1-4-14(19)13(6-10)17(22)23-8-9-5-16(21)24-15-7-11(20)2-3-12(9)15/h1-7,20H,8H2.
What are the key properties of (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate?
(7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate has a molecular weight of 409.62 g/mol, XLogP of 4.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-hydroxy-2-oxochromen-4-yl)methyl 5-bromo-2-chlorobenzoate is sourced from PubChem (CID 139011407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).