About (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate
(7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate (PubChem CID 30402357) has the molecular formula C15H10O5S
and a molecular weight of 302.31 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate.
Molecular Properties
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate |
| PubChem CID | 30402357 |
| Molecular Formula | C15H10O5S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate |
| SMILES | O=C(OCc1cc(=O)oc2cc(O)ccc12)c1ccsc1 |
| InChI | InChI=1S/C15H10O5S/c16-11-1-2-12-10(5-14(17)20-13(12)6-11)7-19-15(18)9-3-4-21-8-9/h1-6,8,16H,7H2 |
| InChIKey | QDUZFFWLOTYOTF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate?
The IUPAC name of (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate (CID 30402357) is (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate.
What is the SMILES notation for (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate?
The canonical SMILES for (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate is O=C(OCc1cc(=O)oc2cc(O)ccc12)c1ccsc1.
What is the InChIKey of (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate?
The InChIKey is QDUZFFWLOTYOTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O5S/c16-11-1-2-12-10(5-14(17)20-13(12)6-11)7-19-15(18)9-3-4-21-8-9/h1-6,8,16H,7H2.
What are the key properties of (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate?
(7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate has a molecular weight of 302.31 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7-hydroxy-2-oxochromen-4-yl)methyl thiophene-3-carboxylate is sourced from PubChem (CID 30402357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).