C17H11BrO6 — CID 30423185
(7-bromo-2-oxochromen-4-yl)methyl 2,4-dihydroxybenzoate (PubChem CID 30423185) has the molecular formula C17H11BrO6 and a molecular weight of 391.17 g/mol. Its IUPAC name is (7-bromo-2-oxochromen-4-yl)methyl 2,4-dihydroxybenzoate.
| Compound Name | (7-bromo-2-oxochromen-4-yl)methyl 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 30423185 |
| Molecular Formula | C17H11BrO6 |
| Molecular Weight | 391.17 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | (7-bromo-2-oxochromen-4-yl)methyl 2,4-dihydroxybenzoate |
| SMILES | O=C(OCc1cc(=O)oc2cc(Br)ccc12)c1ccc(O)cc1O |
| InChI | InChI=1S/C17H11BrO6/c18-10-1-3-12-9(5-16(21)24-15(12)6-10)8-23-17(22)13-4-2-11(19)7-14(13)20/h1-7,19-20H,8H2 |
| InChIKey | RCKNLIUADPTZJK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|