About (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate
(7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate (PubChem CID 27982038) has the molecular formula C17H9Br2FO4
and a molecular weight of 456.06 g/mol. Its IUPAC name is (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate.
Molecular Properties
| Compound Name | (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate |
| PubChem CID | 27982038 |
| Molecular Formula | C17H9Br2FO4 |
| Molecular Weight | 456.06 g/mol |
| Exact Mass | 453.89 |
| IUPAC Name | (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate |
| SMILES | O=C(OCc1cc(=O)oc2cc(Br)ccc12)c1ccc(Br)cc1F |
| InChI | InChI=1S/C17H9Br2FO4/c18-10-2-4-13(14(20)6-10)17(22)23-8-9-5-16(21)24-15-7-11(19)1-3-12(9)15/h1-7H,8H2 |
| InChIKey | VSINKGHISRPEFH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.06 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate?
The IUPAC name of (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate (CID 27982038) is (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate.
What is the SMILES notation for (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate?
The canonical SMILES for (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate is O=C(OCc1cc(=O)oc2cc(Br)ccc12)c1ccc(Br)cc1F.
What is the InChIKey of (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate?
The InChIKey is VSINKGHISRPEFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9Br2FO4/c18-10-2-4-13(14(20)6-10)17(22)23-8-9-5-16(21)24-15-7-11(19)1-3-12(9)15/h1-7H,8H2.
What are the key properties of (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate?
(7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate has a molecular weight of 456.06 g/mol, XLogP of 4.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-2-oxochromen-4-yl)methyl 4-bromo-2-fluorobenzoate is sourced from PubChem (CID 27982038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).