C19H19BrN2O6 — CID 47093843
(7-bromo-2-oxochromen-4-yl)methyl 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 47093843) has the molecular formula C19H19BrN2O6 and a molecular weight of 451.27 g/mol. Its IUPAC name is (7-bromo-2-oxochromen-4-yl)methyl 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | (7-bromo-2-oxochromen-4-yl)methyl 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 47093843 |
| Molecular Formula | C19H19BrN2O6 |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | (7-bromo-2-oxochromen-4-yl)methyl 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)OCc2cc(=O)oc3cc(Br)ccc23)C1=O |
| InChI | InChI=1S/C19H19BrN2O6/c1-3-19(4-2)17(25)22(18(26)21-19)9-16(24)27-10-11-7-15(23)28-14-8-12(20)5-6-13(11)14/h5-8H,3-4,9-10H2,1-2H3,(H,21,26) |
| InChIKey | UTIYMNVOCXGHBF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|