C15H16BrFN2O4 — CID 7793439
(4-bromo-2-fluorophenyl)methyl 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7793439) has the molecular formula C15H16BrFN2O4 and a molecular weight of 387.21 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)methyl 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | (4-bromo-2-fluorophenyl)methyl 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7793439 |
| Molecular Formula | C15H16BrFN2O4 |
| Molecular Weight | 387.21 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | (4-bromo-2-fluorophenyl)methyl 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC[C@]1(C)NC(=O)N(CC(=O)OCc2ccc(Br)cc2F)C1=O |
| InChI | InChI=1S/C15H16BrFN2O4/c1-3-15(2)13(21)19(14(22)18-15)7-12(20)23-8-9-4-5-10(16)6-11(9)17/h4-6H,3,7-8H2,1-2H3,(H,18,22)/t15-/m0/s1 |
| InChIKey | JDXLRUMODIXXDR-HNNXBMFYSA-N |
| XLogP | 2.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|