C16H17F2N3O5 — CID 7793907
[2-(2,6-difluoroanilino)-2-oxoethyl] 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7793907) has the molecular formula C16H17F2N3O5 and a molecular weight of 369.32 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7793907 |
| Molecular Formula | C16H17F2N3O5 |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC[C@@]1(C)NC(=O)N(CC(=O)OCC(=O)Nc2c(F)cccc2F)C1=O |
| InChI | InChI=1S/C16H17F2N3O5/c1-3-16(2)14(24)21(15(25)20-16)7-12(23)26-8-11(22)19-13-9(17)5-4-6-10(13)18/h4-6H,3,7-8H2,1-2H3,(H,19,22)(H,20,25)/t16-/m1/s1 |
| InChIKey | VLPSNTNYQGBTMK-MRXNPFEDSA-N |
| XLogP | 1.17 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|