C17H19F2N3O6 — CID 55311241
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 55311241) has the molecular formula C17H19F2N3O6 and a molecular weight of 399.35 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55311241 |
| Molecular Formula | C17H19F2N3O6 |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(C)NC(=O)N(CC(=O)OCC(=O)Nc2ccccc2OC(F)F)C1=O |
| InChI | InChI=1S/C17H19F2N3O6/c1-3-17(2)14(25)22(16(26)21-17)8-13(24)27-9-12(23)20-10-6-4-5-7-11(10)28-15(18)19/h4-7,15H,3,8-9H2,1-2H3,(H,20,23)(H,21,26) |
| InChIKey | OGSTVGJSTOUHNY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|