C18H23N3O7 — CID 7793351
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7793351) has the molecular formula C18H23N3O7 and a molecular weight of 393.40 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7793351 |
| Molecular Formula | C18H23N3O7 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC[C@]1(C)NC(=O)N(CC(=O)OCC(=O)Nc2ccc(OC)cc2OC)C1=O |
| InChI | InChI=1S/C18H23N3O7/c1-5-18(2)16(24)21(17(25)20-18)9-15(23)28-10-14(22)19-12-7-6-11(26-3)8-13(12)27-4/h6-8H,5,9-10H2,1-4H3,(H,19,22)(H,20,25)/t18-/m0/s1 |
| InChIKey | ZGCBABDONDACIX-SFHVURJKSA-N |
| XLogP | 0.91 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|