C20H27N3O7 — CID 7793638
[2-(3,4-diethoxyanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7793638) has the molecular formula C20H27N3O7 and a molecular weight of 421.45 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7793638 |
| Molecular Formula | C20H27N3O7 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)CN2C(=O)N[C@@](C)(CC)C2=O)cc1OCC |
| InChI | InChI=1S/C20H27N3O7/c1-5-20(4)18(26)23(19(27)22-20)11-17(25)30-12-16(24)21-13-8-9-14(28-6-2)15(10-13)29-7-3/h8-10H,5-7,11-12H2,1-4H3,(H,21,24)(H,22,27)/t20-/m0/s1 |
| InChIKey | JMOAWRATEJSZHK-FQEVSTJZSA-N |
| XLogP | 1.69 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|