C19H23N3O7 — CID 7794040
ethyl 4-[[2-[2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]oxyacetyl]amino]benzoate (PubChem CID 7794040) has the molecular formula C19H23N3O7 and a molecular weight of 405.41 g/mol. Its IUPAC name is ethyl 4-[[2-[2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]oxyacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7794040 |
| Molecular Formula | C19H23N3O7 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | ethyl 4-[[2-[2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)CN2C(=O)N[C@](C)(CC)C2=O)cc1 |
| InChI | InChI=1S/C19H23N3O7/c1-4-19(3)17(26)22(18(27)21-19)10-15(24)29-11-14(23)20-13-8-6-12(7-9-13)16(25)28-5-2/h6-9H,4-5,10-11H2,1-3H3,(H,20,23)(H,21,27)/t19-/m1/s1 |
| InChIKey | SBOZJBHTNNVEMU-LJQANCHMSA-N |
| XLogP | 1.07 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|