C21H27N3O6 — CID 9011116
[2-(4-acetylanilino)-2-oxoethyl] 2-[(4R)-4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 9011116) has the molecular formula C21H27N3O6 and a molecular weight of 417.46 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] 2-[(4R)-4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] 2-[(4R)-4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 9011116 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] 2-[(4R)-4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC(=O)c1ccc(NC(=O)COC(=O)CN2C(=O)N[C@](C)(CCC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C21H27N3O6/c1-13(2)9-10-21(4)19(28)24(20(29)23-21)11-18(27)30-12-17(26)22-16-7-5-15(6-8-16)14(3)25/h5-8,13H,9-12H2,1-4H3,(H,22,26)(H,23,29)/t21-/m1/s1 |
| InChIKey | HJRHMXMFOQPNGF-OAQYLSRUSA-N |
| XLogP | 2.12 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|