C19H22F2N2O5 — CID 9010817
[2-(3,4-difluorophenyl)-2-oxoethyl] 2-[(4R)-4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 9010817) has the molecular formula C19H22F2N2O5 and a molecular weight of 396.39 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 2-[(4R)-4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 2-[(4R)-4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 9010817 |
| Molecular Formula | C19H22F2N2O5 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 2-[(4R)-4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC(C)CC[C@@]1(C)NC(=O)N(CC(=O)OCC(=O)c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C19H22F2N2O5/c1-11(2)6-7-19(3)17(26)23(18(27)22-19)9-16(25)28-10-15(24)12-4-5-13(20)14(21)8-12/h4-5,8,11H,6-7,9-10H2,1-3H3,(H,22,27)/t19-/m1/s1 |
| InChIKey | NIDJEESJNWWOPM-LJQANCHMSA-N |
| XLogP | 2.44 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|