C16H17BrN2O5 — CID 7794129
[2-(4-bromophenyl)-2-oxoethyl] 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7794129) has the molecular formula C16H17BrN2O5 and a molecular weight of 397.23 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7794129 |
| Molecular Formula | C16H17BrN2O5 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CC[C@@]1(C)NC(=O)N(CC(=O)OCC(=O)c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C16H17BrN2O5/c1-3-16(2)14(22)19(15(23)18-16)8-13(21)24-9-12(20)10-4-6-11(17)7-5-10/h4-7H,3,8-9H2,1-2H3,(H,18,23)/t16-/m1/s1 |
| InChIKey | DCFDNDVXWFNIOU-MRXNPFEDSA-N |
| XLogP | 1.90 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|