C14H15ClN2O3 — CID 60623068
3-[2-(4-chlorophenyl)-2-oxoethyl]-5-ethyl-5-methylimidazolidine-2,4-dione (PubChem CID 60623068) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-2-oxoethyl]-5-ethyl-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(4-chlorophenyl)-2-oxoethyl]-5-ethyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60623068 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-2-oxoethyl]-5-ethyl-5-methylimidazolidine-2,4-dione |
| SMILES | CCC1(C)NC(=O)N(CC(=O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C14H15ClN2O3/c1-3-14(2)12(19)17(13(20)16-14)8-11(18)9-4-6-10(15)7-5-9/h4-7H,3,8H2,1-2H3,(H,16,20) |
| InChIKey | YOZIGYDESORBGS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|