C16H19ClN2O3 — CID 2711199
(5R)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-methyl-5-(2-methylpropyl)imidazolidine-2,4-dione (PubChem CID 2711199) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is (5R)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-methyl-5-(2-methylpropyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-methyl-5-(2-methylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2711199 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (5R)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-methyl-5-(2-methylpropyl)imidazolidine-2,4-dione |
| SMILES | CC(C)C[C@@]1(C)NC(=O)N(CC(=O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C16H19ClN2O3/c1-10(2)8-16(3)14(21)19(15(22)18-16)9-13(20)11-4-6-12(17)7-5-11/h4-7,10H,8-9H2,1-3H3,(H,18,22)/t16-/m1/s1 |
| InChIKey | AHURBZFNOGUGDE-MRXNPFEDSA-N |
| XLogP | 2.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|