C16H20N2O3 — CID 60623130
5,5-dimethyl-3-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]imidazolidine-2,4-dione (PubChem CID 60623130) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60623130 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 5,5-dimethyl-3-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]imidazolidine-2,4-dione |
| SMILES | CC(C)c1ccc(C(=O)CN2C(=O)NC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C16H20N2O3/c1-10(2)11-5-7-12(8-6-11)13(19)9-18-14(20)16(3,4)17-15(18)21/h5-8,10H,9H2,1-4H3,(H,17,21) |
| InChIKey | HOEKYWQVMMZASR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|